C14H18ClFO2 — CID 63541856
2-(2-chloro-4-fluorophenyl)-2-propylpentanoic acid (PubChem CID 63541856) has the molecular formula C14H18ClFO2 and a molecular weight of 272.75 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-2-propylpentanoic acid.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-2-propylpentanoic acid |
|---|---|
| PubChem CID | 63541856 |
| Molecular Formula | C14H18ClFO2 |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-2-propylpentanoic acid |
| SMILES | CCCC(CCC)(C(=O)O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H18ClFO2/c1-3-7-14(8-4-2,13(17)18)11-6-5-10(16)9-12(11)15/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | IEAZUSNQLPSHDG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |