acetic acid;1,2-dichloro-4-fluorobenzene

C8H7Cl2FO2 — CID 174538740

IUPACacetic acid;1,2-dichloro-4-fluorobenzene
SMILESCC(=O)O.Fc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C6H3Cl2F.C2H4O2/c7-5-2-1-4(9)3-6(5)8;1-2(3)4/h1-3H;1H3,(H,3,4)
InChIKeySSEVTBNLJIUGML-UHFFFAOYSA-N
MW225.05 g/mol
LogP3.22
Rot. Bonds

About acetic acid;1,2-dichloro-4-fluorobenzene

acetic acid;1,2-dichloro-4-fluorobenzene (PubChem CID 174538740) has the molecular formula C8H7Cl2FO2 and a molecular weight of 225.05 g/mol. Its IUPAC name is acetic acid;1,2-dichloro-4-fluorobenzene.

Molecular Properties

Compound Nameacetic acid;1,2-dichloro-4-fluorobenzene
PubChem CID174538740
Molecular FormulaC8H7Cl2FO2
Molecular Weight225.05 g/mol
Exact Mass223.98
IUPAC Nameacetic acid;1,2-dichloro-4-fluorobenzene
SMILESCC(=O)O.Fc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C6H3Cl2F.C2H4O2/c7-5-2-1-4(9)3-6(5)8;1-2(3)4/h1-3H;1H3,(H,3,4)
InChIKeySSEVTBNLJIUGML-UHFFFAOYSA-N
XLogP3.22
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.05
LogP ≤ 53.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze acetic acid;1,2-dichloro-4-fluorobenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1,2-dichloro-4-fluorobenzene?
The IUPAC name of acetic acid;1,2-dichloro-4-fluorobenzene (CID 174538740) is acetic acid;1,2-dichloro-4-fluorobenzene.
What is the SMILES notation for acetic acid;1,2-dichloro-4-fluorobenzene?
The canonical SMILES for acetic acid;1,2-dichloro-4-fluorobenzene is CC(=O)O.Fc1ccc(Cl)c(Cl)c1.
What is the InChIKey of acetic acid;1,2-dichloro-4-fluorobenzene?
The InChIKey is SSEVTBNLJIUGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2F.C2H4O2/c7-5-2-1-4(9)3-6(5)8;1-2(3)4/h1-3H;1H3,(H,3,4).
What are the key properties of acetic acid;1,2-dichloro-4-fluorobenzene?
acetic acid;1,2-dichloro-4-fluorobenzene has a molecular weight of 225.05 g/mol, XLogP of 3.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1,2-dichloro-4-fluorobenzene is sourced from PubChem (CID 174538740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).