C8H7Cl2FO2 — CID 174538740
acetic acid;1,2-dichloro-4-fluorobenzene (PubChem CID 174538740) has the molecular formula C8H7Cl2FO2 and a molecular weight of 225.05 g/mol. Its IUPAC name is acetic acid;1,2-dichloro-4-fluorobenzene.
| Compound Name | acetic acid;1,2-dichloro-4-fluorobenzene |
|---|---|
| PubChem CID | 174538740 |
| Molecular Formula | C8H7Cl2FO2 |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | acetic acid;1,2-dichloro-4-fluorobenzene |
| SMILES | CC(=O)O.Fc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2F.C2H4O2/c7-5-2-1-4(9)3-6(5)8;1-2(3)4/h1-3H;1H3,(H,3,4) |
| InChIKey | SSEVTBNLJIUGML-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|