About 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid
2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid (PubChem CID 159908135) has the molecular formula C14H8Cl2F2O4
and a molecular weight of 349.12 g/mol. Its IUPAC name is 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid.
Molecular Properties
| Compound Name | 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid |
| PubChem CID | 159908135 |
| Molecular Formula | C14H8Cl2F2O4 |
| Molecular Weight | 349.12 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1Cl.O=C(O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/2C7H4ClFO2/c8-6-2-1-4(9)3-5(6)7(10)11;8-6-3-4(9)1-2-5(6)7(10)11/h2*1-3H,(H,10,11) |
| InChIKey | NWVIGRITRBRTSU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.12 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid?
The IUPAC name of 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid (CID 159908135) is 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid.
What is the SMILES notation for 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid?
The canonical SMILES for 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid is O=C(O)c1cc(F)ccc1Cl.O=C(O)c1ccc(F)cc1Cl.
What is the InChIKey of 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid?
The InChIKey is NWVIGRITRBRTSU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H4ClFO2/c8-6-2-1-4(9)3-5(6)7(10)11;8-6-3-4(9)1-2-5(6)7(10)11/h2*1-3H,(H,10,11).
What are the key properties of 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid?
2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid has a molecular weight of 349.12 g/mol, XLogP of 4.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-fluorobenzoic acid;2-chloro-5-fluorobenzoic acid is sourced from PubChem (CID 159908135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).