C7H10N2O2 — CID 130971072
(2R)-2-amino-2-(1H-pyrrol-2-yl)propanoic acid (PubChem CID 130971072) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is (2R)-2-amino-2-(1H-pyrrol-2-yl)propanoic acid.
| Compound Name | (2R)-2-amino-2-(1H-pyrrol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 130971072 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (2R)-2-amino-2-(1H-pyrrol-2-yl)propanoic acid |
| SMILES | C[C@](N)(C(=O)O)c1ccc[nH]1 |
| InChI | InChI=1S/C7H10N2O2/c1-7(8,6(10)11)5-3-2-4-9-5/h2-4,9H,8H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | SYXRBVQGLLPJFS-SSDOTTSWSA-N |
| XLogP | 0.27 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |