C9H14N2O2 — CID 115127877
2-methyl-2-[methyl(1H-pyrrol-2-yl)amino]propanoic acid (PubChem CID 115127877) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-methyl-2-[methyl(1H-pyrrol-2-yl)amino]propanoic acid.
| Compound Name | 2-methyl-2-[methyl(1H-pyrrol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 115127877 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-methyl-2-[methyl(1H-pyrrol-2-yl)amino]propanoic acid |
| SMILES | CN(c1ccc[nH]1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C9H14N2O2/c1-9(2,8(12)13)11(3)7-5-4-6-10-7/h4-6,10H,1-3H3,(H,12,13) |
| InChIKey | SYGKYDYVDHITPP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |