C13H20N2O4S — CID 62818911
2-[2-(dimethylsulfamoyl)-N-methylanilino]-2-methylpropanoic acid (PubChem CID 62818911) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[2-(dimethylsulfamoyl)-N-methylanilino]-2-methylpropanoic acid.
| Compound Name | 2-[2-(dimethylsulfamoyl)-N-methylanilino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818911 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[2-(dimethylsulfamoyl)-N-methylanilino]-2-methylpropanoic acid |
| SMILES | CN(c1ccccc1S(=O)(=O)N(C)C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H20N2O4S/c1-13(2,12(16)17)15(5)10-8-6-7-9-11(10)20(18,19)14(3)4/h6-9H,1-5H3,(H,16,17) |
| InChIKey | LZEDMJUIDBDEGT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |