C12H19BrN2O2S — CID 113426409
2-[1-bromopropan-2-yl(methyl)amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 113426409) has the molecular formula C12H19BrN2O2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 2-[1-bromopropan-2-yl(methyl)amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[1-bromopropan-2-yl(methyl)amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113426409 |
| Molecular Formula | C12H19BrN2O2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-[1-bromopropan-2-yl(methyl)amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC(CBr)N(C)c1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H19BrN2O2S/c1-10(9-13)15(4)11-7-5-6-8-12(11)18(16,17)14(2)3/h5-8,10H,9H2,1-4H3 |
| InChIKey | VPOLSXOAFUNXKM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|