C10H15NO3S — CID 14006033
2-(1-hydroxyethyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 14006033) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-(1-hydroxyethyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 14006033 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 2-(1-hydroxyethyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CC(O)c1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H15NO3S/c1-8(12)9-6-4-5-7-10(9)15(13,14)11(2)3/h4-8,12H,1-3H3 |
| InChIKey | QMXDSQWIVWMDQO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |