C11H16F3NO — CID 143399660
2-(4-aminophenyl)-1,1,1-trifluoropropan-2-ol;ethane (PubChem CID 143399660) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1,1,1-trifluoropropan-2-ol;ethane.
| Compound Name | 2-(4-aminophenyl)-1,1,1-trifluoropropan-2-ol;ethane |
|---|---|
| PubChem CID | 143399660 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(4-aminophenyl)-1,1,1-trifluoropropan-2-ol;ethane |
| SMILES | CC.CC(O)(c1ccc(N)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO.C2H6/c1-8(14,9(10,11)12)6-2-4-7(13)5-3-6;1-2/h2-5,14H,13H2,1H3;1-2H3 |
| InChIKey | SOZTZXOLQRXTNI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|