C13H21F3OS — CID 171099400
ethane;1,1,1-trifluoro-2-(4-sulfanylphenyl)propan-2-ol (PubChem CID 171099400) has the molecular formula C13H21F3OS and a molecular weight of 282.37 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-2-(4-sulfanylphenyl)propan-2-ol.
| Compound Name | ethane;1,1,1-trifluoro-2-(4-sulfanylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 171099400 |
| Molecular Formula | C13H21F3OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | ethane;1,1,1-trifluoro-2-(4-sulfanylphenyl)propan-2-ol |
| SMILES | CC.CC.CC(O)(c1ccc(S)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H9F3OS.2C2H6/c1-8(13,9(10,11)12)6-2-4-7(14)5-3-6;2*1-2/h2-5,13-14H,1H3;2*1-2H3 |
| InChIKey | YXOLKAVGNNNQRE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|