C13H20F3NO3 — CID 145146727
ethane;1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-ol (PubChem CID 145146727) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-ol.
| Compound Name | ethane;1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-ol |
|---|---|
| PubChem CID | 145146727 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethane;1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-ol |
| SMILES | CC.CC.CC(O)(c1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO3.2C2H6/c1-8(14,9(10,11)12)6-2-4-7(5-3-6)13(15)16;2*1-2/h2-5,14H,1H3;2*1-2H3 |
| InChIKey | XMGHDCUTMKOTAO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|