C12H17NO2 — CID 121011525
1-(2,3-dimethylbutan-2-yl)-4-nitrobenzene (PubChem CID 121011525) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(2,3-dimethylbutan-2-yl)-4-nitrobenzene.
| Compound Name | 1-(2,3-dimethylbutan-2-yl)-4-nitrobenzene |
|---|---|
| PubChem CID | 121011525 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-(2,3-dimethylbutan-2-yl)-4-nitrobenzene |
| SMILES | CC(C)C(C)(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H17NO2/c1-9(2)12(3,4)10-5-7-11(8-6-10)13(14)15/h5-9H,1-4H3 |
| InChIKey | AJRBNIFAVCFALE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|