C36H32N2O6 — CID 15217324
1,4-bis[2-[4-(4-nitrophenoxy)phenyl]propan-2-yl]benzene (PubChem CID 15217324) has the molecular formula C36H32N2O6 and a molecular weight of 588.66 g/mol. Its IUPAC name is 1,4-bis[2-[4-(4-nitrophenoxy)phenyl]propan-2-yl]benzene.
| Compound Name | 1,4-bis[2-[4-(4-nitrophenoxy)phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 15217324 |
| Molecular Formula | C36H32N2O6 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 1,4-bis[2-[4-(4-nitrophenoxy)phenyl]propan-2-yl]benzene |
| SMILES | CC(C)(c1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1)c1ccc(C(C)(C)c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C36H32N2O6/c1-35(2,27-9-17-31(18-10-27)43-33-21-13-29(14-22-33)37(39)40)25-5-7-26(8-6-25)36(3,4)28-11-19-32(20-12-28)44-34-23-15-30(16-24-34)38(41)42/h5-24H,1-4H3 |
| InChIKey | ZJEOOFPJAPHLAX-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|