C28H22N4O13 — CID 20979717
1-[1-[1,1-bis(4-nitrophenoxy)ethoxy]-1-(4-nitrophenoxy)ethoxy]-4-nitrobenzene (PubChem CID 20979717) has the molecular formula C28H22N4O13 and a molecular weight of 622.50 g/mol. Its IUPAC name is 1-[1-[1,1-bis(4-nitrophenoxy)ethoxy]-1-(4-nitrophenoxy)ethoxy]-4-nitrobenzene.
| Compound Name | 1-[1-[1,1-bis(4-nitrophenoxy)ethoxy]-1-(4-nitrophenoxy)ethoxy]-4-nitrobenzene |
|---|---|
| PubChem CID | 20979717 |
| Molecular Formula | C28H22N4O13 |
| Molecular Weight | 622.50 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | 1-[1-[1,1-bis(4-nitrophenoxy)ethoxy]-1-(4-nitrophenoxy)ethoxy]-4-nitrobenzene |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1)(Oc1ccc([N+](=O)[O-])cc1)OC(C)(Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H22N4O13/c1-27(41-23-11-3-19(4-12-23)29(33)34,42-24-13-5-20(6-14-24)30(35)36)45-28(2,43-25-15-7-21(8-16-25)31(37)38)44-26-17-9-22(10-18-26)32(39)40/h3-18H,1-2H3 |
| InChIKey | NRDFVWCCNCKTBE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 218.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|