C12H14INO3 — CID 10497821
1-[(E)-1-iodo-3,3-dimethylbut-1-en-2-yl]oxy-4-nitrobenzene (PubChem CID 10497821) has the molecular formula C12H14INO3 and a molecular weight of 347.15 g/mol. Its IUPAC name is 1-[(E)-1-iodo-3,3-dimethylbut-1-en-2-yl]oxy-4-nitrobenzene.
| Compound Name | 1-[(E)-1-iodo-3,3-dimethylbut-1-en-2-yl]oxy-4-nitrobenzene |
|---|---|
| PubChem CID | 10497821 |
| Molecular Formula | C12H14INO3 |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 1-[(E)-1-iodo-3,3-dimethylbut-1-en-2-yl]oxy-4-nitrobenzene |
| SMILES | CC(C)(C)/C(=C\I)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14INO3/c1-12(2,3)11(8-13)17-10-6-4-9(5-7-10)14(15)16/h4-8H,1-3H3/b11-8+ |
| InChIKey | GNUJRBKJNVZXII-DHZHZOJOSA-N |
| XLogP | 4.30 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|