C11H13NO5 — CID 45038528
[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] (4-nitrophenyl) carbonate (PubChem CID 45038528) has the molecular formula C11H13NO5 and a molecular weight of 248.28 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] (4-nitrophenyl) carbonate.
| Compound Name | [1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 45038528 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] (4-nitrophenyl) carbonate |
| SMILES | [2H]C([2H])([2H])C(OC(=O)Oc1ccc([N+](=O)[O-])cc1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C11H13NO5/c1-11(2,3)17-10(13)16-9-6-4-8(5-7-9)12(14)15/h4-7H,1-3H3/i1D3,2D3,3D3 |
| InChIKey | XNPGBDJTEBCMHA-GQALSZNTSA-N |
| XLogP | 2.91 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|