C15H21NO7 — CID 71315983
(1,1-diethoxy-2-methylpropan-2-yl) (4-nitrophenyl) carbonate (PubChem CID 71315983) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is (1,1-diethoxy-2-methylpropan-2-yl) (4-nitrophenyl) carbonate.
| Compound Name | (1,1-diethoxy-2-methylpropan-2-yl) (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 71315983 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (1,1-diethoxy-2-methylpropan-2-yl) (4-nitrophenyl) carbonate |
| SMILES | CCOC(OCC)C(C)(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H21NO7/c1-5-20-13(21-6-2)15(3,4)23-14(17)22-12-9-7-11(8-10-12)16(18)19/h7-10,13H,5-6H2,1-4H3 |
| InChIKey | RJQOVDVGEWOCIA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|