C16H23NO5S2 — CID 174178879
[4-(ethyldisulfanyl)-2,4-dimethylpentan-2-yl] (4-nitrophenyl) carbonate (PubChem CID 174178879) has the molecular formula C16H23NO5S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is [4-(ethyldisulfanyl)-2,4-dimethylpentan-2-yl] (4-nitrophenyl) carbonate.
| Compound Name | [4-(ethyldisulfanyl)-2,4-dimethylpentan-2-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 174178879 |
| Molecular Formula | C16H23NO5S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [4-(ethyldisulfanyl)-2,4-dimethylpentan-2-yl] (4-nitrophenyl) carbonate |
| SMILES | CCSSC(C)(C)CC(C)(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H23NO5S2/c1-6-23-24-16(4,5)11-15(2,3)22-14(18)21-13-9-7-12(8-10-13)17(19)20/h7-10H,6,11H2,1-5H3 |
| InChIKey | PSSBHSKYTYRRNW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|