About [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate
[3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate (PubChem CID 130394501) has the molecular formula C18H27NO6
and a molecular weight of 353.42 g/mol. Its IUPAC name is [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate |
| PubChem CID | 130394501 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate |
| SMILES | CCC(C)(C)OCCC(C)(CC)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H27NO6/c1-6-17(3,4)23-13-12-18(5,7-2)25-16(20)24-15-10-8-14(9-11-15)19(21)22/h8-11H,6-7,12-13H2,1-5H3 |
| InChIKey | MWAVIZSTQFNHEG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate?
The IUPAC name of [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate (CID 130394501) is [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate.
What is the SMILES notation for [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate?
The canonical SMILES for [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate is CCC(C)(C)OCCC(C)(CC)OC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate?
The InChIKey is MWAVIZSTQFNHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO6/c1-6-17(3,4)23-13-12-18(5,7-2)25-16(20)24-15-10-8-14(9-11-15)19(21)22/h8-11H,6-7,12-13H2,1-5H3.
What are the key properties of [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate?
[3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate has a molecular weight of 353.42 g/mol, XLogP of 4.87, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-(2-methylbutan-2-yloxy)pentan-3-yl] (4-nitrophenyl) carbonate is sourced from PubChem (CID 130394501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).