C18H29NO7 — CID 143061259
3-methoxy-3-methylbutan-1-ol;3-methylbutyl (4-nitrophenyl) carbonate (PubChem CID 143061259) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is 3-methoxy-3-methylbutan-1-ol;3-methylbutyl (4-nitrophenyl) carbonate.
| Compound Name | 3-methoxy-3-methylbutan-1-ol;3-methylbutyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 143061259 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 3-methoxy-3-methylbutan-1-ol;3-methylbutyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)CCOC(=O)Oc1ccc([N+](=O)[O-])cc1.COC(C)(C)CCO |
| InChI | InChI=1S/C12H15NO5.C6H14O2/c1-9(2)7-8-17-12(14)18-11-5-3-10(4-6-11)13(15)16;1-6(2,8-3)4-5-7/h3-6,9H,7-8H2,1-2H3;7H,4-5H2,1-3H3 |
| InChIKey | ATHYOBBYKKXJCU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|