C19H25NO10 — CID 102294111
1-O-(2-hydroxyethyl) 5-O-[2-(4-nitrophenoxy)carbonyloxyethyl] 2,2,4-trimethylpentanedioate (PubChem CID 102294111) has the molecular formula C19H25NO10 and a molecular weight of 427.41 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-[2-(4-nitrophenoxy)carbonyloxyethyl] 2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-[2-(4-nitrophenoxy)carbonyloxyethyl] 2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 102294111 |
| Molecular Formula | C19H25NO10 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-[2-(4-nitrophenoxy)carbonyloxyethyl] 2,2,4-trimethylpentanedioate |
| SMILES | CC(CC(C)(C)C(=O)OCCO)C(=O)OCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H25NO10/c1-13(12-19(2,3)17(23)28-9-8-21)16(22)27-10-11-29-18(24)30-15-6-4-14(5-7-15)20(25)26/h4-7,13,21H,8-12H2,1-3H3 |
| InChIKey | NILSIQWUCAKFHA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|