C25H31N3O12 — CID 166786823
2-[2-amino-4-[2-methyl-4-(4-nitrophenoxy)carbonyloxybutan-2-yl]oxybutan-2-yl]oxyethyl (4-nitrophenyl) carbonate (PubChem CID 166786823) has the molecular formula C25H31N3O12 and a molecular weight of 565.53 g/mol. Its IUPAC name is 2-[2-amino-4-[2-methyl-4-(4-nitrophenoxy)carbonyloxybutan-2-yl]oxybutan-2-yl]oxyethyl (4-nitrophenyl) carbonate.
| Compound Name | 2-[2-amino-4-[2-methyl-4-(4-nitrophenoxy)carbonyloxybutan-2-yl]oxybutan-2-yl]oxyethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 166786823 |
| Molecular Formula | C25H31N3O12 |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-[2-amino-4-[2-methyl-4-(4-nitrophenoxy)carbonyloxybutan-2-yl]oxybutan-2-yl]oxyethyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)(CCOC(=O)Oc1ccc([N+](=O)[O-])cc1)OCCC(C)(N)OCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H31N3O12/c1-24(2,12-14-35-22(29)39-20-8-4-18(5-9-20)27(31)32)37-15-13-25(3,26)38-17-16-36-23(30)40-21-10-6-19(7-11-21)28(33)34/h4-11H,12-17,26H2,1-3H3 |
| InChIKey | REIWACGENQEHAW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 201.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|