C26H34N2O9 — CID 123951984
2-[4-[4-(4-aminophenoxy)carbonyloxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl (4-nitrosophenyl) carbonate (PubChem CID 123951984) has the molecular formula C26H34N2O9 and a molecular weight of 518.56 g/mol. Its IUPAC name is 2-[4-[4-(4-aminophenoxy)carbonyloxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl (4-nitrosophenyl) carbonate.
| Compound Name | 2-[4-[4-(4-aminophenoxy)carbonyloxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl (4-nitrosophenyl) carbonate |
|---|---|
| PubChem CID | 123951984 |
| Molecular Formula | C26H34N2O9 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 2-[4-[4-(4-aminophenoxy)carbonyloxy-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]oxyethyl (4-nitrosophenyl) carbonate |
| SMILES | CC(C)(CCOC(=O)Oc1ccc(N)cc1)OCCC(C)(C)OCCOC(=O)Oc1ccc(N=O)cc1 |
| InChI | InChI=1S/C26H34N2O9/c1-25(2,13-15-32-23(29)36-21-9-5-19(27)6-10-21)34-16-14-26(3,4)35-18-17-33-24(30)37-22-11-7-20(28-31)8-12-22/h5-12H,13-18,27H2,1-4H3 |
| InChIKey | CPCLPLLYSWKFFH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|