C11H10F3NO4 — CID 88934920
(4-nitrosophenyl) (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate (PubChem CID 88934920) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is (4-nitrosophenyl) (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate.
| Compound Name | (4-nitrosophenyl) (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate |
|---|---|
| PubChem CID | 88934920 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | (4-nitrosophenyl) (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate |
| SMILES | CC(C)(OC(=O)Oc1ccc(N=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO4/c1-10(2,11(12,13)14)19-9(16)18-8-5-3-7(15-17)4-6-8/h3-6H,1-2H3 |
| InChIKey | OZWMYOXMRBWLSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|