C21H22F2O4 — CID 168800861
tert-butyl [4-[difluoro-(4-prop-1-en-2-ylphenyl)methoxy]phenyl] carbonate (PubChem CID 168800861) has the molecular formula C21H22F2O4 and a molecular weight of 376.40 g/mol. Its IUPAC name is tert-butyl [4-[difluoro-(4-prop-1-en-2-ylphenyl)methoxy]phenyl] carbonate.
| Compound Name | tert-butyl [4-[difluoro-(4-prop-1-en-2-ylphenyl)methoxy]phenyl] carbonate |
|---|---|
| PubChem CID | 168800861 |
| Molecular Formula | C21H22F2O4 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | tert-butyl [4-[difluoro-(4-prop-1-en-2-ylphenyl)methoxy]phenyl] carbonate |
| SMILES | C=C(C)c1ccc(C(F)(F)Oc2ccc(OC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H22F2O4/c1-14(2)15-6-8-16(9-7-15)21(22,23)26-18-12-10-17(11-13-18)25-19(24)27-20(3,4)5/h6-13H,1H2,2-5H3 |
| InChIKey | MRAORZKVZVUJJN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|