C28H32O10 — CID 73054651
dimethyl (E)-2,3-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]but-2-enedioate (PubChem CID 73054651) has the molecular formula C28H32O10 and a molecular weight of 528.55 g/mol. Its IUPAC name is dimethyl (E)-2,3-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]but-2-enedioate.
| Compound Name | dimethyl (E)-2,3-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]but-2-enedioate |
|---|---|
| PubChem CID | 73054651 |
| Molecular Formula | C28H32O10 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | dimethyl (E)-2,3-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]but-2-enedioate |
| SMILES | COC(=O)/C(=C(/C(=O)OC)c1ccc(OC(=O)OC(C)(C)C)cc1)c1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H32O10/c1-27(2,3)37-25(31)35-19-13-9-17(10-14-19)21(23(29)33-7)22(24(30)34-8)18-11-15-20(16-12-18)36-26(32)38-28(4,5)6/h9-16H,1-8H3/b22-21+ |
| InChIKey | XWPLGRZFHHREJB-QURGRASLSA-N |
| XLogP | 5.57 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|