C26H32O6 — CID 67421785
tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;methyl 2-methylprop-2-enoate (PubChem CID 67421785) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;methyl 2-methylprop-2-enoate.
| Compound Name | tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67421785 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | tert-butyl (4-ethenylphenyl) carbonate;4-ethenylphenol;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=Cc1ccc(O)cc1.C=Cc1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H16O3.C8H8O.C5H8O2/c1-5-10-6-8-11(9-7-10)15-12(14)16-13(2,3)4;1-2-7-3-5-8(9)6-4-7;1-4(2)5(6)7-3/h5-9H,1H2,2-4H3;2-6,9H,1H2;1H2,2-3H3 |
| InChIKey | ATVRLOKBEPOJJI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|