About ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate
ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 144902381) has the molecular formula C21H26O3
and a molecular weight of 326.44 g/mol. Its IUPAC name is ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| PubChem CID | 144902381 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=Cc1ccc(OC(=O)/C=C/c2ccc(O)cc2)cc1.CC.CC |
| InChI | InChI=1S/C17H14O3.2C2H6/c1-2-13-5-10-16(11-6-13)20-17(19)12-7-14-3-8-15(18)9-4-14;2*1-2/h2-12,18H,1H2;2*1-2H3/b12-7+;; |
| InChIKey | HJTHSPGGILQGAV-CURPJKDSSA-N |
| XLogP | 5.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate?
The IUPAC name of ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate (CID 144902381) is ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate.
What is the SMILES notation for ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate?
The canonical SMILES for ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate is C=Cc1ccc(OC(=O)/C=C/c2ccc(O)cc2)cc1.CC.CC.
What is the InChIKey of ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate?
The InChIKey is HJTHSPGGILQGAV-CURPJKDSSA-N. The full InChI is InChI=1S/C17H14O3.2C2H6/c1-2-13-5-10-16(11-6-13)20-17(19)12-7-14-3-8-15(18)9-4-14;2*1-2/h2-12,18H,1H2;2*1-2H3/b12-7+;;.
What are the key properties of ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate?
ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate has a molecular weight of 326.44 g/mol, XLogP of 5.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-ethenylphenyl) (E)-3-(4-hydroxyphenyl)prop-2-enoate is sourced from PubChem (CID 144902381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).