About ethane;ethene;4-ethenylphenol
ethane;ethene;4-ethenylphenol (PubChem CID 178000559) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is ethane;ethene;4-ethenylphenol.
Molecular Properties
| Compound Name | ethane;ethene;4-ethenylphenol |
| PubChem CID | 178000559 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | ethane;ethene;4-ethenylphenol |
| SMILES | C=C.C=Cc1ccc(O)cc1.CC |
| InChI | InChI=1S/C8H8O.C2H6.C2H4/c1-2-7-3-5-8(9)6-4-7;2*1-2/h2-6,9H,1H2;1-2H3;1-2H2 |
| InChIKey | CRWTVNAHKWYEOF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;4-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;4-ethenylphenol?
The IUPAC name of ethane;ethene;4-ethenylphenol (CID 178000559) is ethane;ethene;4-ethenylphenol.
What is the SMILES notation for ethane;ethene;4-ethenylphenol?
The canonical SMILES for ethane;ethene;4-ethenylphenol is C=C.C=Cc1ccc(O)cc1.CC.
What is the InChIKey of ethane;ethene;4-ethenylphenol?
The InChIKey is CRWTVNAHKWYEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H6.C2H4/c1-2-7-3-5-8(9)6-4-7;2*1-2/h2-6,9H,1H2;1-2H3;1-2H2.
What are the key properties of ethane;ethene;4-ethenylphenol?
ethane;ethene;4-ethenylphenol has a molecular weight of 178.27 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;4-ethenylphenol is sourced from PubChem (CID 178000559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).