About 4-ethenylphenol;propan-2-ol
4-ethenylphenol;propan-2-ol (PubChem CID 159910746) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-ethenylphenol;propan-2-ol.
Molecular Properties
| Compound Name | 4-ethenylphenol;propan-2-ol |
| PubChem CID | 159910746 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-ethenylphenol;propan-2-ol |
| SMILES | C=Cc1ccc(O)cc1.CC(C)O |
| InChI | InChI=1S/C8H8O.C3H8O/c1-2-7-3-5-8(9)6-4-7;1-3(2)4/h2-6,9H,1H2;3-4H,1-2H3 |
| InChIKey | NXDUIPQGGXJRHO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethenylphenol;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylphenol;propan-2-ol?
The IUPAC name of 4-ethenylphenol;propan-2-ol (CID 159910746) is 4-ethenylphenol;propan-2-ol.
What is the SMILES notation for 4-ethenylphenol;propan-2-ol?
The canonical SMILES for 4-ethenylphenol;propan-2-ol is C=Cc1ccc(O)cc1.CC(C)O.
What is the InChIKey of 4-ethenylphenol;propan-2-ol?
The InChIKey is NXDUIPQGGXJRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C3H8O/c1-2-7-3-5-8(9)6-4-7;1-3(2)4/h2-6,9H,1H2;3-4H,1-2H3.
What are the key properties of 4-ethenylphenol;propan-2-ol?
4-ethenylphenol;propan-2-ol has a molecular weight of 180.25 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylphenol;propan-2-ol is sourced from PubChem (CID 159910746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).