About 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene
4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene (PubChem CID 67420429) has the molecular formula C19H22O2
and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene.
Molecular Properties
| Compound Name | 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene |
| PubChem CID | 67420429 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene |
| SMILES | C=Cc1ccc(O)cc1.C=Cc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C11H14O.C8H8O/c1-4-10-5-7-11(8-6-10)12-9(2)3;1-2-7-3-5-8(9)6-4-7/h4-9H,1H2,2-3H3;2-6,9H,1H2 |
| InChIKey | VGOOREHQAIJCKI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene?
The IUPAC name of 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene (CID 67420429) is 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene.
What is the SMILES notation for 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene?
The canonical SMILES for 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene is C=Cc1ccc(O)cc1.C=Cc1ccc(OC(C)C)cc1.
What is the InChIKey of 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene?
The InChIKey is VGOOREHQAIJCKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C8H8O/c1-4-10-5-7-11(8-6-10)12-9(2)3;1-2-7-3-5-8(9)6-4-7/h4-9H,1H2,2-3H3;2-6,9H,1H2.
What are the key properties of 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene?
4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene has a molecular weight of 282.38 g/mol, XLogP of 5.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylphenol;1-ethenyl-4-propan-2-yloxybenzene is sourced from PubChem (CID 67420429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).