About ethane;4-propan-2-yloxyphenol
ethane;4-propan-2-yloxyphenol (PubChem CID 142348653) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is ethane;4-propan-2-yloxyphenol.
Molecular Properties
| Compound Name | ethane;4-propan-2-yloxyphenol |
| PubChem CID | 142348653 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethane;4-propan-2-yloxyphenol |
| SMILES | CC.CC(C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C9H12O2.C2H6/c1-7(2)11-9-5-3-8(10)4-6-9;1-2/h3-7,10H,1-2H3;1-2H3 |
| InChIKey | XBFVRBDONBIIAJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-propan-2-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-propan-2-yloxyphenol?
The IUPAC name of ethane;4-propan-2-yloxyphenol (CID 142348653) is ethane;4-propan-2-yloxyphenol.
What is the SMILES notation for ethane;4-propan-2-yloxyphenol?
The canonical SMILES for ethane;4-propan-2-yloxyphenol is CC.CC(C)Oc1ccc(O)cc1.
What is the InChIKey of ethane;4-propan-2-yloxyphenol?
The InChIKey is XBFVRBDONBIIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C2H6/c1-7(2)11-9-5-3-8(10)4-6-9;1-2/h3-7,10H,1-2H3;1-2H3.
What are the key properties of ethane;4-propan-2-yloxyphenol?
ethane;4-propan-2-yloxyphenol has a molecular weight of 182.26 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-propan-2-yloxyphenol is sourced from PubChem (CID 142348653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).