C30H30O8S2 — CID 66718430
4-[4-[3-[4-(4-propan-2-yloxyphenyl)sulfonylphenoxy]propoxy]phenyl]sulfonylphenol (PubChem CID 66718430) has the molecular formula C30H30O8S2 and a molecular weight of 582.70 g/mol. Its IUPAC name is 4-[4-[3-[4-(4-propan-2-yloxyphenyl)sulfonylphenoxy]propoxy]phenyl]sulfonylphenol.
| Compound Name | 4-[4-[3-[4-(4-propan-2-yloxyphenyl)sulfonylphenoxy]propoxy]phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 66718430 |
| Molecular Formula | C30H30O8S2 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | 4-[4-[3-[4-(4-propan-2-yloxyphenyl)sulfonylphenoxy]propoxy]phenyl]sulfonylphenol |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)c2ccc(OCCCOc3ccc(S(=O)(=O)c4ccc(O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H30O8S2/c1-22(2)38-26-10-18-30(19-11-26)40(34,35)29-16-8-25(9-17-29)37-21-3-20-36-24-6-14-28(15-7-24)39(32,33)27-12-4-23(31)5-13-27/h4-19,22,31H,3,20-21H2,1-2H3 |
| InChIKey | BZTJBYBWHCSIJP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|