C29H28O8S4 — CID 87292826
4-[4-[1-[1-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethylsulfanylmethylsulfanyl]ethoxy]phenyl]sulfonylphenol (PubChem CID 87292826) has the molecular formula C29H28O8S4 and a molecular weight of 632.80 g/mol. Its IUPAC name is 4-[4-[1-[1-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethylsulfanylmethylsulfanyl]ethoxy]phenyl]sulfonylphenol.
| Compound Name | 4-[4-[1-[1-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethylsulfanylmethylsulfanyl]ethoxy]phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 87292826 |
| Molecular Formula | C29H28O8S4 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.07 |
| IUPAC Name | 4-[4-[1-[1-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethylsulfanylmethylsulfanyl]ethoxy]phenyl]sulfonylphenol |
| SMILES | CC(Oc1ccc(S(=O)(=O)c2ccc(O)cc2)cc1)SCSC(C)Oc1ccc(S(=O)(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C29H28O8S4/c1-20(36-24-7-15-28(16-8-24)40(32,33)26-11-3-22(30)4-12-26)38-19-39-21(2)37-25-9-17-29(18-10-25)41(34,35)27-13-5-23(31)6-14-27/h3-18,20-21,30-31H,19H2,1-2H3 |
| InChIKey | AZFKAWFSJLBVPK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|