About CID 70636806
CID 70636806 (PubChem CID 70636806) has the molecular formula C12H10Na2O4S
and a molecular weight of 296.26 g/mol.
Molecular Properties
| Compound Name | CID 70636806 |
| PubChem CID | 70636806 |
| Molecular Formula | C12H10Na2O4S |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | — |
| SMILES | O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1.[Na].[Na] |
| InChI | InChI=1S/C12H10O4S.2Na/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;;/h1-8,13-14H;; |
| InChIKey | RJRMISKUJGROGZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 70636806 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70636806?
The IUPAC name of CID 70636806 (CID 70636806) is not available.
What is the SMILES notation for CID 70636806?
The canonical SMILES for CID 70636806 is O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1.[Na].[Na].
What is the InChIKey of CID 70636806?
The InChIKey is RJRMISKUJGROGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4S.2Na/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;;/h1-8,13-14H;;.
What are the key properties of CID 70636806?
CID 70636806 has a molecular weight of 296.26 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70636806 is sourced from PubChem (CID 70636806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).