C19H18O9S2 — CID 170852655
formaldehyde;4-hydroxybenzenesulfonic acid;4-(4-hydroxyphenyl)sulfonylphenol (PubChem CID 170852655) has the molecular formula C19H18O9S2 and a molecular weight of 454.48 g/mol. Its IUPAC name is formaldehyde;4-hydroxybenzenesulfonic acid;4-(4-hydroxyphenyl)sulfonylphenol.
| Compound Name | formaldehyde;4-hydroxybenzenesulfonic acid;4-(4-hydroxyphenyl)sulfonylphenol |
|---|---|
| PubChem CID | 170852655 |
| Molecular Formula | C19H18O9S2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | formaldehyde;4-hydroxybenzenesulfonic acid;4-(4-hydroxyphenyl)sulfonylphenol |
| SMILES | C=O.O=S(=O)(O)c1ccc(O)cc1.O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H10O4S.C6H6O4S.CH2O/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;7-5-1-3-6(4-2-5)11(8,9)10;1-2/h1-8,13-14H;1-4,7H,(H,8,9,10);1H2 |
| InChIKey | ZXKRDOPCCCNQLY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|