About 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate
4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate (PubChem CID 101301315) has the molecular formula C12H10O8PbS2
and a molecular weight of 553.54 g/mol. Its IUPAC name is 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate.
Molecular Properties
| Compound Name | 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate |
| PubChem CID | 101301315 |
| Molecular Formula | C12H10O8PbS2 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate |
| SMILES | O=S(=O)(O)c1ccc(O)cc1.O=S(=O)([O-])c1ccc([O-])cc1.[Pb+2] |
| InChI | InChI=1S/2C6H6O4S.Pb/c2*7-5-1-3-6(4-2-5)11(8,9)10;/h2*1-4,7H,(H,8,9,10);/q;;+2/p-2 |
| InChIKey | KDMRZXXAKLQYQE-UHFFFAOYSA-L |
| XLogP | -0.08 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate?
The IUPAC name of 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate (CID 101301315) is 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate.
What is the SMILES notation for 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate?
The canonical SMILES for 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate is O=S(=O)(O)c1ccc(O)cc1.O=S(=O)([O-])c1ccc([O-])cc1.[Pb+2].
What is the InChIKey of 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate?
The InChIKey is KDMRZXXAKLQYQE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H6O4S.Pb/c2*7-5-1-3-6(4-2-5)11(8,9)10;/h2*1-4,7H,(H,8,9,10);/q;;+2/p-2.
What are the key properties of 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate?
4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate has a molecular weight of 553.54 g/mol, XLogP of -0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzenesulfonic acid;lead(2+);4-oxidobenzenesulfonate is sourced from PubChem (CID 101301315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).