About 4-hydroxybenzenesulfonate;pyridin-1-ium
4-hydroxybenzenesulfonate;pyridin-1-ium (PubChem CID 121451813) has the molecular formula C11H11NO4S
and a molecular weight of 253.28 g/mol. Its IUPAC name is 4-hydroxybenzenesulfonate;pyridin-1-ium.
Molecular Properties
| Compound Name | 4-hydroxybenzenesulfonate;pyridin-1-ium |
| PubChem CID | 121451813 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4-hydroxybenzenesulfonate;pyridin-1-ium |
| SMILES | O=S(=O)([O-])c1ccc(O)cc1.c1cc[nH+]cc1 |
| InChI | InChI=1S/C6H6O4S.C5H5N/c7-5-1-3-6(4-2-5)11(8,9)10;1-2-4-6-5-3-1/h1-4,7H,(H,8,9,10);1-5H |
| InChIKey | AHKHCABWJGFHOG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybenzenesulfonate;pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzenesulfonate;pyridin-1-ium?
The IUPAC name of 4-hydroxybenzenesulfonate;pyridin-1-ium (CID 121451813) is 4-hydroxybenzenesulfonate;pyridin-1-ium.
What is the SMILES notation for 4-hydroxybenzenesulfonate;pyridin-1-ium?
The canonical SMILES for 4-hydroxybenzenesulfonate;pyridin-1-ium is O=S(=O)([O-])c1ccc(O)cc1.c1cc[nH+]cc1.
What is the InChIKey of 4-hydroxybenzenesulfonate;pyridin-1-ium?
The InChIKey is AHKHCABWJGFHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4S.C5H5N/c7-5-1-3-6(4-2-5)11(8,9)10;1-2-4-6-5-3-1/h1-4,7H,(H,8,9,10);1-5H.
What are the key properties of 4-hydroxybenzenesulfonate;pyridin-1-ium?
4-hydroxybenzenesulfonate;pyridin-1-ium has a molecular weight of 253.28 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzenesulfonate;pyridin-1-ium is sourced from PubChem (CID 121451813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).