C12H13NO4S — CID 45157592
4-methylbenzenesulfonate;pyridin-1-ium-2-ol (PubChem CID 45157592) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;pyridin-1-ium-2-ol.
| Compound Name | 4-methylbenzenesulfonate;pyridin-1-ium-2-ol |
|---|---|
| PubChem CID | 45157592 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-methylbenzenesulfonate;pyridin-1-ium-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Oc1cccc[nH+]1 |
| InChI | InChI=1S/C7H8O3S.C5H5NO/c1-6-2-4-7(5-3-6)11(8,9)10;7-5-3-1-2-4-6-5/h2-5H,1H3,(H,8,9,10);1-4H,(H,6,7) |
| InChIKey | LKAICDYIYAEMNK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|