About 4-methylbenzenesulfonate;quinolin-1-ium
4-methylbenzenesulfonate;quinolin-1-ium (PubChem CID 11702180) has the molecular formula C16H15NO3S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;quinolin-1-ium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;quinolin-1-ium |
| PubChem CID | 11702180 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-methylbenzenesulfonate;quinolin-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.c1ccc2[nH+]cccc2c1 |
| InChI | InChI=1S/C9H7N.C7H8O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-6-2-4-7(5-3-6)11(8,9)10/h1-7H;2-5H,1H3,(H,8,9,10) |
| InChIKey | RENADKAYIYTQNG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;quinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;quinolin-1-ium?
The IUPAC name of 4-methylbenzenesulfonate;quinolin-1-ium (CID 11702180) is 4-methylbenzenesulfonate;quinolin-1-ium.
What is the SMILES notation for 4-methylbenzenesulfonate;quinolin-1-ium?
The canonical SMILES for 4-methylbenzenesulfonate;quinolin-1-ium is Cc1ccc(S(=O)(=O)[O-])cc1.c1ccc2[nH+]cccc2c1.
What is the InChIKey of 4-methylbenzenesulfonate;quinolin-1-ium?
The InChIKey is RENADKAYIYTQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H8O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-6-2-4-7(5-3-6)11(8,9)10/h1-7H;2-5H,1H3,(H,8,9,10).
What are the key properties of 4-methylbenzenesulfonate;quinolin-1-ium?
4-methylbenzenesulfonate;quinolin-1-ium has a molecular weight of 301.37 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;quinolin-1-ium is sourced from PubChem (CID 11702180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).