C18H16N2O3S — CID 139632146
1H-benzo[f]benzimidazol-3-ium;4-methylbenzenesulfonate (PubChem CID 139632146) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 1H-benzo[f]benzimidazol-3-ium;4-methylbenzenesulfonate.
| Compound Name | 1H-benzo[f]benzimidazol-3-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139632146 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1H-benzo[f]benzimidazol-3-ium;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.c1ccc2cc3[nH+]c[nH]c3cc2c1 |
| InChI | InChI=1S/C11H8N2.C7H8O3S/c1-2-4-9-6-11-10(12-7-13-11)5-8(9)3-1;1-6-2-4-7(5-3-6)11(8,9)10/h1-7H,(H,12,13);2-5H,1H3,(H,8,9,10) |
| InChIKey | KUDBDZKVBMSSBQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|