About quinolin-1-ium sulfamate
quinolin-1-ium sulfamate (PubChem CID 11680206) has the molecular formula C9H10N2O3S
and a molecular weight of 226.26 g/mol. Its IUPAC name is quinolin-1-ium sulfamate.
Molecular Properties
| Compound Name | quinolin-1-ium sulfamate |
| PubChem CID | 11680206 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | quinolin-1-ium sulfamate |
| SMILES | NS(=O)(=O)[O-].c1ccc2[nH+]cccc2c1 |
| InChI | InChI=1S/C9H7N.H3NO3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-5(2,3)4/h1-7H;(H3,1,2,3,4) |
| InChIKey | WWOIMTOBHGMHBN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze quinolin-1-ium sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-1-ium sulfamate?
The IUPAC name of quinolin-1-ium sulfamate (CID 11680206) is quinolin-1-ium sulfamate.
What is the SMILES notation for quinolin-1-ium sulfamate?
The canonical SMILES for quinolin-1-ium sulfamate is NS(=O)(=O)[O-].c1ccc2[nH+]cccc2c1.
What is the InChIKey of quinolin-1-ium sulfamate?
The InChIKey is WWOIMTOBHGMHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.H3NO3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-5(2,3)4/h1-7H;(H3,1,2,3,4).
What are the key properties of quinolin-1-ium sulfamate?
quinolin-1-ium sulfamate has a molecular weight of 226.26 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-1-ium sulfamate is sourced from PubChem (CID 11680206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).