About lithium quinolin-1-ium-8-ol
lithium quinolin-1-ium-8-ol (PubChem CID 166010386) has the molecular formula C9H8LiNO+2
and a molecular weight of 153.11 g/mol. Its IUPAC name is lithium quinolin-1-ium-8-ol.
Molecular Properties
| Compound Name | lithium quinolin-1-ium-8-ol |
| PubChem CID | 166010386 |
| Molecular Formula | C9H8LiNO+2 |
| Molecular Weight | 153.11 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | lithium quinolin-1-ium-8-ol |
| SMILES | Oc1cccc2ccc[nH+]c12.[Li+] |
| InChI | InChI=1S/C9H7NO.Li/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;/q;+1/p+1 |
| InChIKey | FQHFBFXXYOQXMN-UHFFFAOYSA-O |
| XLogP | -1.64 |
| TPSA | 34.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.11 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium quinolin-1-ium-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium quinolin-1-ium-8-ol?
The IUPAC name of lithium quinolin-1-ium-8-ol (CID 166010386) is lithium quinolin-1-ium-8-ol.
What is the SMILES notation for lithium quinolin-1-ium-8-ol?
The canonical SMILES for lithium quinolin-1-ium-8-ol is Oc1cccc2ccc[nH+]c12.[Li+].
What is the InChIKey of lithium quinolin-1-ium-8-ol?
The InChIKey is FQHFBFXXYOQXMN-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H7NO.Li/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;/q;+1/p+1.
What are the key properties of lithium quinolin-1-ium-8-ol?
lithium quinolin-1-ium-8-ol has a molecular weight of 153.11 g/mol, XLogP of -1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium quinolin-1-ium-8-ol is sourced from PubChem (CID 166010386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).