C11H13NO5S — CID 139085053
5,7-dimethylquinolin-1-ium-8-ol;hydrogen sulfate (PubChem CID 139085053) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 5,7-dimethylquinolin-1-ium-8-ol;hydrogen sulfate.
| Compound Name | 5,7-dimethylquinolin-1-ium-8-ol;hydrogen sulfate |
|---|---|
| PubChem CID | 139085053 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5,7-dimethylquinolin-1-ium-8-ol;hydrogen sulfate |
| SMILES | Cc1cc(C)c2ccc[nH+]c2c1O.O=S(=O)([O-])O |
| InChI | InChI=1S/C11H11NO.H2O4S/c1-7-6-8(2)11(13)10-9(7)4-3-5-12-10;1-5(2,3)4/h3-6,13H,1-2H3;(H2,1,2,3,4) |
| InChIKey | HZUYWPBAYYGPKU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|