About phthalate;bis(quinolin-1-ium-8-ol)
phthalate;bis(quinolin-1-ium-8-ol) (PubChem CID 163359214) has the molecular formula C26H20N2O6
and a molecular weight of 456.45 g/mol. Its IUPAC name is phthalate;bis(quinolin-1-ium-8-ol).
Molecular Properties
| Compound Name | phthalate;bis(quinolin-1-ium-8-ol) |
| PubChem CID | 163359214 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | phthalate;bis(quinolin-1-ium-8-ol) |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].Oc1cccc2ccc[nH+]c12.Oc1cccc2ccc[nH+]c12 |
| InChI | InChI=1S/2C9H7NO.C8H6O4/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*1-6,11H;1-4H,(H,9,10)(H,11,12) |
| InChIKey | XDGCVLMLOBGQPM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze phthalate;bis(quinolin-1-ium-8-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalate;bis(quinolin-1-ium-8-ol)?
The IUPAC name of phthalate;bis(quinolin-1-ium-8-ol) (CID 163359214) is phthalate;bis(quinolin-1-ium-8-ol).
What is the SMILES notation for phthalate;bis(quinolin-1-ium-8-ol)?
The canonical SMILES for phthalate;bis(quinolin-1-ium-8-ol) is O=C([O-])c1ccccc1C(=O)[O-].Oc1cccc2ccc[nH+]c12.Oc1cccc2ccc[nH+]c12.
What is the InChIKey of phthalate;bis(quinolin-1-ium-8-ol)?
The InChIKey is XDGCVLMLOBGQPM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NO.C8H6O4/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*1-6,11H;1-4H,(H,9,10)(H,11,12).
What are the key properties of phthalate;bis(quinolin-1-ium-8-ol)?
phthalate;bis(quinolin-1-ium-8-ol) has a molecular weight of 456.45 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phthalate;bis(quinolin-1-ium-8-ol) is sourced from PubChem (CID 163359214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).