About lithium;2-hydroxybenzoate;oxalic acid
lithium;2-hydroxybenzoate;oxalic acid (PubChem CID 172798390) has the molecular formula C9H7LiO7
and a molecular weight of 234.09 g/mol. Its IUPAC name is lithium;2-hydroxybenzoate;oxalic acid.
Molecular Properties
| Compound Name | lithium;2-hydroxybenzoate;oxalic acid |
| PubChem CID | 172798390 |
| Molecular Formula | C9H7LiO7 |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | lithium;2-hydroxybenzoate;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C([O-])c1ccccc1O.[Li+] |
| InChI | InChI=1S/C7H6O3.C2H2O4.Li/c8-6-4-2-1-3-5(6)7(9)10;3-1(4)2(5)6;/h1-4,8H,(H,9,10);(H,3,4)(H,5,6);/q;;+1/p-1 |
| InChIKey | QNCCJOBTKWYVNH-UHFFFAOYSA-M |
| XLogP | -4.08 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze lithium;2-hydroxybenzoate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-hydroxybenzoate;oxalic acid?
The IUPAC name of lithium;2-hydroxybenzoate;oxalic acid (CID 172798390) is lithium;2-hydroxybenzoate;oxalic acid.
What is the SMILES notation for lithium;2-hydroxybenzoate;oxalic acid?
The canonical SMILES for lithium;2-hydroxybenzoate;oxalic acid is O=C(O)C(=O)O.O=C([O-])c1ccccc1O.[Li+].
What is the InChIKey of lithium;2-hydroxybenzoate;oxalic acid?
The InChIKey is QNCCJOBTKWYVNH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.C2H2O4.Li/c8-6-4-2-1-3-5(6)7(9)10;3-1(4)2(5)6;/h1-4,8H,(H,9,10);(H,3,4)(H,5,6);/q;;+1/p-1.
What are the key properties of lithium;2-hydroxybenzoate;oxalic acid?
lithium;2-hydroxybenzoate;oxalic acid has a molecular weight of 234.09 g/mol, XLogP of -4.08, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-hydroxybenzoate;oxalic acid is sourced from PubChem (CID 172798390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).