C19H13BeNO+2 — CID 20606751
beryllium 5-naphthalen-1-ylquinolin-1-ium-8-olate (PubChem CID 20606751) has the molecular formula C19H13BeNO+2 and a molecular weight of 280.33 g/mol. Its IUPAC name is beryllium 5-naphthalen-1-ylquinolin-1-ium-8-olate.
| Compound Name | beryllium 5-naphthalen-1-ylquinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 20606751 |
| Molecular Formula | C19H13BeNO+2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | beryllium 5-naphthalen-1-ylquinolin-1-ium-8-olate |
| SMILES | [Be+2].[O-]c1ccc(-c2cccc3ccccc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C19H13NO.Be/c21-18-11-10-16(17-9-4-12-20-19(17)18)15-8-3-6-13-5-1-2-7-14(13)15;/h1-12,21H;/q;+2 |
| InChIKey | VKXUWBKRTKWUBM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |