About bis((E)-but-2-enedioic acid);quinolin-1-ium
bis((E)-but-2-enedioic acid);quinolin-1-ium (PubChem CID 11602969) has the molecular formula C17H16NO8+
and a molecular weight of 362.31 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);quinolin-1-ium.
Molecular Properties
| Compound Name | bis((E)-but-2-enedioic acid);quinolin-1-ium |
| PubChem CID | 11602969 |
| Molecular Formula | C17H16NO8+ |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | bis((E)-but-2-enedioic acid);quinolin-1-ium |
| SMILES | O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.c1ccc2[nH+]cccc2c1 |
| InChI | InChI=1S/C9H7N.2C4H4O4/c1-2-6-9-8(4-1)5-3-7-10-9;2*5-3(6)1-2-4(7)8/h1-7H;2*1-2H,(H,5,6)(H,7,8)/p+1/b;2*2-1+ |
| InChIKey | KUDARRQTFOYWGE-LVEZLNDCSA-O |
| XLogP | 1.08 |
| TPSA | 163.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-but-2-enedioic acid);quinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-but-2-enedioic acid);quinolin-1-ium?
The IUPAC name of bis((E)-but-2-enedioic acid);quinolin-1-ium (CID 11602969) is bis((E)-but-2-enedioic acid);quinolin-1-ium.
What is the SMILES notation for bis((E)-but-2-enedioic acid);quinolin-1-ium?
The canonical SMILES for bis((E)-but-2-enedioic acid);quinolin-1-ium is O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.c1ccc2[nH+]cccc2c1.
What is the InChIKey of bis((E)-but-2-enedioic acid);quinolin-1-ium?
The InChIKey is KUDARRQTFOYWGE-LVEZLNDCSA-O. The full InChI is InChI=1S/C9H7N.2C4H4O4/c1-2-6-9-8(4-1)5-3-7-10-9;2*5-3(6)1-2-4(7)8/h1-7H;2*1-2H,(H,5,6)(H,7,8)/p+1/b;2*2-1+.
What are the key properties of bis((E)-but-2-enedioic acid);quinolin-1-ium?
bis((E)-but-2-enedioic acid);quinolin-1-ium has a molecular weight of 362.31 g/mol, XLogP of 1.08, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-but-2-enedioic acid);quinolin-1-ium is sourced from PubChem (CID 11602969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).