About aniline;but-2-enedioic acid
aniline;but-2-enedioic acid (PubChem CID 160758978) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is aniline;but-2-enedioic acid.
Molecular Properties
| Compound Name | aniline;but-2-enedioic acid |
| PubChem CID | 160758978 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | aniline;but-2-enedioic acid |
| SMILES | Nc1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C6H7N.C4H4O4/c7-6-4-2-1-3-5-6;5-3(6)1-2-4(7)8/h1-5H,7H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RXUORJSZMBEMGC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze aniline;but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;but-2-enedioic acid?
The IUPAC name of aniline;but-2-enedioic acid (CID 160758978) is aniline;but-2-enedioic acid.
What is the SMILES notation for aniline;but-2-enedioic acid?
The canonical SMILES for aniline;but-2-enedioic acid is Nc1ccccc1.O=C(O)C=CC(=O)O.
What is the InChIKey of aniline;but-2-enedioic acid?
The InChIKey is RXUORJSZMBEMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.C4H4O4/c7-6-4-2-1-3-5-6;5-3(6)1-2-4(7)8/h1-5H,7H2;1-2H,(H,5,6)(H,7,8).
What are the key properties of aniline;but-2-enedioic acid?
aniline;but-2-enedioic acid has a molecular weight of 209.20 g/mol, XLogP of 0.98, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;but-2-enedioic acid is sourced from PubChem (CID 160758978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).