About aniline;dichloro (Z)-but-2-enedioate
aniline;dichloro (Z)-but-2-enedioate (PubChem CID 174895369) has the molecular formula C10H9Cl2NO4
and a molecular weight of 278.09 g/mol. Its IUPAC name is aniline;dichloro (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | aniline;dichloro (Z)-but-2-enedioate |
| PubChem CID | 174895369 |
| Molecular Formula | C10H9Cl2NO4 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | aniline;dichloro (Z)-but-2-enedioate |
| SMILES | Nc1ccccc1.O=C(/C=C\C(=O)OCl)OCl |
| InChI | InChI=1S/C6H7N.C4H2Cl2O4/c7-6-4-2-1-3-5-6;5-9-3(7)1-2-4(8)10-6/h1-5H,7H2;1-2H/b;2-1- |
| InChIKey | RTMGNTSXUPACDY-BTJKTKAUSA-N |
| XLogP | 2.21 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze aniline;dichloro (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;dichloro (Z)-but-2-enedioate?
The IUPAC name of aniline;dichloro (Z)-but-2-enedioate (CID 174895369) is aniline;dichloro (Z)-but-2-enedioate.
What is the SMILES notation for aniline;dichloro (Z)-but-2-enedioate?
The canonical SMILES for aniline;dichloro (Z)-but-2-enedioate is Nc1ccccc1.O=C(/C=C\C(=O)OCl)OCl.
What is the InChIKey of aniline;dichloro (Z)-but-2-enedioate?
The InChIKey is RTMGNTSXUPACDY-BTJKTKAUSA-N. The full InChI is InChI=1S/C6H7N.C4H2Cl2O4/c7-6-4-2-1-3-5-6;5-9-3(7)1-2-4(8)10-6/h1-5H,7H2;1-2H/b;2-1-.
What are the key properties of aniline;dichloro (Z)-but-2-enedioate?
aniline;dichloro (Z)-but-2-enedioate has a molecular weight of 278.09 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;dichloro (Z)-but-2-enedioate is sourced from PubChem (CID 174895369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).